C15H10ClNS — CID 162410994
11b-chloro-11aH-[1]benzothiolo[3,2-c]isoquinoline (PubChem CID 162410994) has the molecular formula C15H10ClNS and a molecular weight of 271.77 g/mol. Its IUPAC name is 11b-chloro-11aH-[1]benzothiolo[3,2-c]isoquinoline.
| Compound Name | 11b-chloro-11aH-[1]benzothiolo[3,2-c]isoquinoline |
|---|---|
| PubChem CID | 162410994 |
| Molecular Formula | C15H10ClNS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 11b-chloro-11aH-[1]benzothiolo[3,2-c]isoquinoline |
| SMILES | ClC12C=CC=CC1=CN=C1c3ccccc3SC12 |
| InChI | InChI=1S/C15H10ClNS/c16-15-8-4-3-5-10(15)9-17-13-11-6-1-2-7-12(11)18-14(13)15/h1-9,14H |
| InChIKey | ODJGZSANNTXRKS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|