C13H10ClNS — CID 70858452
6-chloro-4a,11a-dihydrobenzo[b][1,4]benzothiazepine (PubChem CID 70858452) has the molecular formula C13H10ClNS and a molecular weight of 247.75 g/mol. Its IUPAC name is 6-chloro-4a,11a-dihydrobenzo[b][1,4]benzothiazepine.
| Compound Name | 6-chloro-4a,11a-dihydrobenzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 70858452 |
| Molecular Formula | C13H10ClNS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 6-chloro-4a,11a-dihydrobenzo[b][1,4]benzothiazepine |
| SMILES | ClC1=NC2C=CC=CC2Sc2ccccc21 |
| InChI | InChI=1S/C13H10ClNS/c14-13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)15-13/h1-8,10,12H |
| InChIKey | BSMPHUKTISQYAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |