C10H7F3N2O2 — CID 10562224
7-methoxy-5-(trifluoromethyl)-1H-1,8-naphthyridin-2-one (PubChem CID 10562224) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 7-methoxy-5-(trifluoromethyl)-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-methoxy-5-(trifluoromethyl)-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 10562224 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 7-methoxy-5-(trifluoromethyl)-1H-1,8-naphthyridin-2-one |
| SMILES | COc1cc(C(F)(F)F)c2ccc(=O)[nH]c2n1 |
| InChI | InChI=1S/C10H7F3N2O2/c1-17-8-4-6(10(11,12)13)5-2-3-7(16)14-9(5)15-8/h2-4H,1H3,(H,14,15,16) |
| InChIKey | HYGFVQDIVWDUCZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |