C17H14N2O2 — CID 10564534
(5-oxo-3,4-dihydropyrrol-2-yl) N-phenylbenzenecarboximidate (PubChem CID 10564534) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (5-oxo-3,4-dihydropyrrol-2-yl) N-phenylbenzenecarboximidate.
| Compound Name | (5-oxo-3,4-dihydropyrrol-2-yl) N-phenylbenzenecarboximidate |
|---|---|
| PubChem CID | 10564534 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (5-oxo-3,4-dihydropyrrol-2-yl) N-phenylbenzenecarboximidate |
| SMILES | O=C1CCC(O/C(=N/c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C17H14N2O2/c20-15-11-12-16(19-15)21-17(13-7-3-1-4-8-13)18-14-9-5-2-6-10-14/h1-10H,11-12H2/b18-17+ |
| InChIKey | AYKLGOGOCKGICT-ISLYRVAYSA-N |
| XLogP | 3.50 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|