C32H33NO2Si2 — CID 154718999
phenyl 9-oxo-N-phenyl-1,2-bis(trimethylsilyl)fluorene-3-carboximidate (PubChem CID 154718999) has the molecular formula C32H33NO2Si2 and a molecular weight of 519.79 g/mol. Its IUPAC name is phenyl 9-oxo-N-phenyl-1,2-bis(trimethylsilyl)fluorene-3-carboximidate.
| Compound Name | phenyl 9-oxo-N-phenyl-1,2-bis(trimethylsilyl)fluorene-3-carboximidate |
|---|---|
| PubChem CID | 154718999 |
| Molecular Formula | C32H33NO2Si2 |
| Molecular Weight | 519.79 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | phenyl 9-oxo-N-phenyl-1,2-bis(trimethylsilyl)fluorene-3-carboximidate |
| SMILES | C[Si](C)(C)c1c(/C(=N/c2ccccc2)Oc2ccccc2)cc2c(c1[Si](C)(C)C)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C32H33NO2Si2/c1-36(2,3)30-27(32(33-22-15-9-7-10-16-22)35-23-17-11-8-12-18-23)21-26-24-19-13-14-20-25(24)29(34)28(26)31(30)37(4,5)6/h7-21H,1-6H3/b33-32- |
| InChIKey | WLTXMXGSNSDDSW-KARKAFJISA-N |
| XLogP | 7.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.79 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|