C25H29N5O4 — CID 1056497
N-[2-[[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-methyl-4-nitrobenzamide (PubChem CID 1056497) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-methyl-4-nitrobenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 1056497 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2,4-dimethylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-methyl-4-nitrobenzamide |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)CN(C)C(=O)c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C25H29N5O4/c1-16-7-12-20(17(2)13-16)29-22(14-21(27-29)25(3,4)5)26-23(31)15-28(6)24(32)18-8-10-19(11-9-18)30(33)34/h7-14H,15H2,1-6H3,(H,26,31) |
| InChIKey | PIVJVQVWSADBIC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|