C14H20N6O — CID 10565296
(11R,15S)-4-[(dimethylamino)methyl]-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one (PubChem CID 10565296) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is (11R,15S)-4-[(dimethylamino)methyl]-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one.
| Compound Name | (11R,15S)-4-[(dimethylamino)methyl]-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 10565296 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (11R,15S)-4-[(dimethylamino)methyl]-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
| SMILES | CN(C)Cc1nc2c([nH]1)C(=O)N(C)C1=N[C@@H]3CCC[C@@H]3N12 |
| InChI | InChI=1S/C14H20N6O/c1-18(2)7-10-16-11-12(17-10)20-9-6-4-5-8(9)15-14(20)19(3)13(11)21/h8-9H,4-7H2,1-3H3,(H,16,17)/t8-,9+/m1/s1 |
| InChIKey | WZMCNGMZEUXKFK-BDAKNGLRSA-N |
| XLogP | 0.65 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |