C17H23NO3 — CID 10565360
(3aS,4S,5R,6R,6aR)-5-benzyl-4-ethenyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 10565360) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (3aS,4S,5R,6R,6aR)-5-benzyl-4-ethenyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aS,4S,5R,6R,6aR)-5-benzyl-4-ethenyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 10565360 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (3aS,4S,5R,6R,6aR)-5-benzyl-4-ethenyl-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | C=C[C@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](C)[N@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-5-14-16-15(20-17(3,4)21-16)12(2)18(14,19)11-13-9-7-6-8-10-13/h5-10,12,14-16H,1,11H2,2-4H3/t12-,14+,15-,16+,18-/m1/s1 |
| InChIKey | JLNQPUWXWMNOBP-JLPXDJIOSA-N |
| XLogP | 2.98 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|