C16H30O4Si — CID 10567292
(5R,6R,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(hydroxymethyl)-1-oxaspiro[4.4]nonan-2-one (PubChem CID 10567292) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is (5R,6R,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(hydroxymethyl)-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (5R,6R,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(hydroxymethyl)-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 10567292 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (5R,6R,9S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(hydroxymethyl)-1-oxaspiro[4.4]nonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC[C@H](CO)[C@]12CCC(=O)O2 |
| InChI | InChI=1S/C16H30O4Si/c1-15(2,3)21(4,5)19-11-13-7-6-12(10-17)16(13)9-8-14(18)20-16/h12-13,17H,6-11H2,1-5H3/t12-,13+,16-/m1/s1 |
| InChIKey | RVIQYSHPIIOMHK-DVOMOZLQSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|