C15H13N3O5 — CID 10567324
(2E)-2-[hydroxy(phenyl)methylidene]-1-(3-methyl-5-nitroimidazol-4-yl)butane-1,3-dione (PubChem CID 10567324) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is (2E)-2-[hydroxy(phenyl)methylidene]-1-(3-methyl-5-nitroimidazol-4-yl)butane-1,3-dione.
| Compound Name | (2E)-2-[hydroxy(phenyl)methylidene]-1-(3-methyl-5-nitroimidazol-4-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 10567324 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (2E)-2-[hydroxy(phenyl)methylidene]-1-(3-methyl-5-nitroimidazol-4-yl)butane-1,3-dione |
| SMILES | CC(=O)/C(C(=O)c1c([N+](=O)[O-])ncn1C)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C15H13N3O5/c1-9(19)11(13(20)10-6-4-3-5-7-10)14(21)12-15(18(22)23)16-8-17(12)2/h3-8,20H,1-2H3/b13-11+ |
| InChIKey | GIZWJIZBKANZOG-ACCUITESSA-N |
| XLogP | 2.07 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|