C18H26N2O3 — CID 10567575
2-[(2S,6R)-2-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]-N-methoxy-N-methylacetamide (PubChem CID 10567575) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(2S,6R)-2-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(2S,6R)-2-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 10567575 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-[(2S,6R)-2-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)C[C@@H]1C=CC[C@@H](C[C@H](O)c2ccccc2)N1C |
| InChI | InChI=1S/C18H26N2O3/c1-19-15(12-17(21)14-8-5-4-6-9-14)10-7-11-16(19)13-18(22)20(2)23-3/h4-9,11,15-17,21H,10,12-13H2,1-3H3/t15-,16-,17-/m0/s1 |
| InChIKey | XCPCZXQLAYVMGW-ULQDDVLXSA-N |
| XLogP | 2.15 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|