C18H26OSSi — CID 10567599
2-(1-phenylsulfanyl-3-trimethylsilylprop-2-ynyl)cyclohexan-1-ol (PubChem CID 10567599) has the molecular formula C18H26OSSi and a molecular weight of 318.56 g/mol. Its IUPAC name is 2-(1-phenylsulfanyl-3-trimethylsilylprop-2-ynyl)cyclohexan-1-ol.
| Compound Name | 2-(1-phenylsulfanyl-3-trimethylsilylprop-2-ynyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10567599 |
| Molecular Formula | C18H26OSSi |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(1-phenylsulfanyl-3-trimethylsilylprop-2-ynyl)cyclohexan-1-ol |
| SMILES | C[Si](C)(C)C#CC(Sc1ccccc1)C1CCCCC1O |
| InChI | InChI=1S/C18H26OSSi/c1-21(2,3)14-13-18(16-11-7-8-12-17(16)19)20-15-9-5-4-6-10-15/h4-6,9-10,16-19H,7-8,11-12H2,1-3H3 |
| InChIKey | FSROFVALIBWRBD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|