C19H29NO3 — CID 10567660
N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]octanamide (PubChem CID 10567660) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]octanamide.
| Compound Name | N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]octanamide |
|---|---|
| PubChem CID | 10567660 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-[(E,2S,3R)-1,3-dihydroxy-5-phenylpent-4-en-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@@H](CO)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H29NO3/c1-2-3-4-5-9-12-19(23)20-17(15-21)18(22)14-13-16-10-7-6-8-11-16/h6-8,10-11,13-14,17-18,21-22H,2-5,9,12,15H2,1H3,(H,20,23)/b14-13+/t17-,18+/m0/s1 |
| InChIKey | VDHPPBXSLIQPND-DPYIKZRWSA-N |
| XLogP | 2.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|