About 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one
8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 10567839) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
Molecular Properties
| Compound Name | 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| PubChem CID | 10567839 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)CN(Cc1ccncc1)CC3 |
| InChI | InChI=1S/C19H18N2O3/c1-23-14-2-3-16-15-6-9-21(11-13-4-7-20-8-5-13)12-17(15)19(22)24-18(16)10-14/h2-5,7-8,10H,6,9,11-12H2,1H3 |
| InChIKey | LRQWWKKYRRTJBN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
The IUPAC name of 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (CID 10567839) is 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
What is the SMILES notation for 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
The canonical SMILES for 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one is COc1ccc2c3c(c(=O)oc2c1)CN(Cc1ccncc1)CC3.
What is the InChIKey of 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
The InChIKey is LRQWWKKYRRTJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-23-14-2-3-16-15-6-9-21(11-13-4-7-20-8-5-13)12-17(15)19(22)24-18(16)10-14/h2-5,7-8,10H,6,9,11-12H2,1H3.
What are the key properties of 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one has a molecular weight of 322.36 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-3-(pyridin-4-ylmethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one is sourced from PubChem (CID 10567839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).