C20H22N2O2 — CID 10567857
butyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (PubChem CID 10567857) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is butyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate.
| Compound Name | butyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
|---|---|
| PubChem CID | 10567857 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | butyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| SMILES | CCCCOC(=O)Cc1c(-c2ccccc2)nc2ccc(C)cn12 |
| InChI | InChI=1S/C20H22N2O2/c1-3-4-12-24-19(23)13-17-20(16-8-6-5-7-9-16)21-18-11-10-15(2)14-22(17)18/h5-11,14H,3-4,12-13H2,1-2H3 |
| InChIKey | ZMDIVQGWEPFKGD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|