C18H20O7 — CID 10569715
[(1R,5S,6R)-5-acetyloxy-1-[(2E,4E)-hexa-2,4-dienoyl]-3,5-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-2-yl] acetate (PubChem CID 10569715) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is [(1R,5S,6R)-5-acetyloxy-1-[(2E,4E)-hexa-2,4-dienoyl]-3,5-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-2-yl] acetate.
| Compound Name | [(1R,5S,6R)-5-acetyloxy-1-[(2E,4E)-hexa-2,4-dienoyl]-3,5-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-2-yl] acetate |
|---|---|
| PubChem CID | 10569715 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(1R,5S,6R)-5-acetyloxy-1-[(2E,4E)-hexa-2,4-dienoyl]-3,5-dimethyl-4-oxo-7-oxabicyclo[4.1.0]hept-2-en-2-yl] acetate |
| SMILES | C/C=C/C=C/C(=O)[C@@]12O[C@@H]1[C@](C)(OC(C)=O)C(=O)C(C)=C2OC(C)=O |
| InChI | InChI=1S/C18H20O7/c1-6-7-8-9-13(21)18-15(23-11(3)19)10(2)14(22)17(5,16(18)25-18)24-12(4)20/h6-9,16H,1-5H3/b7-6+,9-8+/t16-,17-,18+/m1/s1 |
| InChIKey | HWQSWVPCFKQDKK-RIPNIGQKSA-N |
| XLogP | 1.57 |
| TPSA | 99.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|