C16H19F3O3S — CID 10569724
ethyl 4,4,4-trifluoro-3-oxo-2-[(4-propan-2-ylsulfanylphenyl)methyl]butanoate (PubChem CID 10569724) has the molecular formula C16H19F3O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-oxo-2-[(4-propan-2-ylsulfanylphenyl)methyl]butanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-oxo-2-[(4-propan-2-ylsulfanylphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 10569724 |
| Molecular Formula | C16H19F3O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-oxo-2-[(4-propan-2-ylsulfanylphenyl)methyl]butanoate |
| SMILES | CCOC(=O)C(Cc1ccc(SC(C)C)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H19F3O3S/c1-4-22-15(21)13(14(20)16(17,18)19)9-11-5-7-12(8-6-11)23-10(2)3/h5-8,10,13H,4,9H2,1-3H3 |
| InChIKey | DQAGBUXAKFFKMT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|