C20H18N2O5 — CID 10570898
8-methoxy-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 10570898) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 8-methoxy-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
| Compound Name | 8-methoxy-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 10570898 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 8-methoxy-3-[(4-nitrophenyl)methyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)CN(Cc1ccc([N+](=O)[O-])cc1)CC3 |
| InChI | InChI=1S/C20H18N2O5/c1-26-15-6-7-17-16-8-9-21(12-18(16)20(23)27-19(17)10-15)11-13-2-4-14(5-3-13)22(24)25/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | HHRUJJWXMZRWIG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|