C22H12ClN5 — CID 10571921
7-chloro-14-phenyl-1,3,11,12,20-pentazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2,4(9),5,7,10,12,14,16(21),17,19-decaene (PubChem CID 10571921) has the molecular formula C22H12ClN5 and a molecular weight of 381.83 g/mol. Its IUPAC name is 7-chloro-14-phenyl-1,3,11,12,20-pentazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2,4(9),5,7,10,12,14,16(21),17,19-decaene.
| Compound Name | 7-chloro-14-phenyl-1,3,11,12,20-pentazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2,4(9),5,7,10,12,14,16(21),17,19-decaene |
|---|---|
| PubChem CID | 10571921 |
| Molecular Formula | C22H12ClN5 |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 7-chloro-14-phenyl-1,3,11,12,20-pentazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2,4(9),5,7,10,12,14,16(21),17,19-decaene |
| SMILES | Clc1ccc2nc3n4c(nnc-3c2c1)c(-c1ccccc1)cc1cccnc14 |
| InChI | InChI=1S/C22H12ClN5/c23-15-8-9-18-17(12-15)19-22(25-18)28-20-14(7-4-10-24-20)11-16(21(28)27-26-19)13-5-2-1-3-6-13/h1-12H |
| InChIKey | MBFPVSVDVRDOBM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|