C17H13IN3+ — CID 132533186
9-iodo-7-methyl-6-phenylimidazo[1,2-a][1,8]naphthyridin-7-ium (PubChem CID 132533186) has the molecular formula C17H13IN3+ and a molecular weight of 386.22 g/mol. Its IUPAC name is 9-iodo-7-methyl-6-phenylimidazo[1,2-a][1,8]naphthyridin-7-ium.
| Compound Name | 9-iodo-7-methyl-6-phenylimidazo[1,2-a][1,8]naphthyridin-7-ium |
|---|---|
| PubChem CID | 132533186 |
| Molecular Formula | C17H13IN3+ |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 9-iodo-7-methyl-6-phenylimidazo[1,2-a][1,8]naphthyridin-7-ium |
| SMILES | C[n+]1cc(I)n2c3ncccc3cc(-c3ccccc3)c21 |
| InChI | InChI=1S/C17H13IN3/c1-20-11-15(18)21-16-13(8-5-9-19-16)10-14(17(20)21)12-6-3-2-4-7-12/h2-11H,1H3/q+1 |
| InChIKey | BPFHLFGVLZTXHK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|