C18H30O7Si — CID 10572232
methyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7a-formyl-7-methoxy-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-4-carboxylate (PubChem CID 10572232) has the molecular formula C18H30O7Si and a molecular weight of 386.52 g/mol. Its IUPAC name is methyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7a-formyl-7-methoxy-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-4-carboxylate.
| Compound Name | methyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7a-formyl-7-methoxy-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 10572232 |
| Molecular Formula | C18H30O7Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | methyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7a-formyl-7-methoxy-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC)[C@@]2(C=O)OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C18H30O7Si/c1-17(2,3)26(6,7)25-13-8-11(16(21)23-5)12-9-14(20)24-18(12,10-19)15(13)22-4/h10-13,15H,8-9H2,1-7H3/t11-,12-,13+,15-,18-/m0/s1 |
| InChIKey | ZNBJGGONBNCSJM-OZNCCCKXSA-N |
| XLogP | 2.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|