C19H34O8Si — CID 10835826
dimethyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-methoxy-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-4,7a-dicarboxylate (PubChem CID 10835826) has the molecular formula C19H34O8Si and a molecular weight of 418.56 g/mol. Its IUPAC name is dimethyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-methoxy-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-4,7a-dicarboxylate.
| Compound Name | dimethyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-methoxy-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-4,7a-dicarboxylate |
|---|---|
| PubChem CID | 10835826 |
| Molecular Formula | C19H34O8Si |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | dimethyl (3aS,4S,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-methoxy-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-4,7a-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC)[C@@]2(C(=O)OC)OC(O)C[C@@H]12 |
| InChI | InChI=1S/C19H34O8Si/c1-18(2,3)28(7,8)27-13-9-11(16(21)24-5)12-10-14(20)26-19(12,15(13)23-4)17(22)25-6/h11-15,20H,9-10H2,1-8H3/t11-,12-,13+,14?,15-,19-/m0/s1 |
| InChIKey | YCGDTPUFXOMQSW-BSGKVVNWSA-N |
| XLogP | 1.85 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|