C24H27NO4 — CID 10572648
tert-butyl N-[(2R,3S,4Z)-5-oxo-2-phenyl-4-(3-phenylpropylidene)oxolan-3-yl]carbamate (PubChem CID 10572648) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,4Z)-5-oxo-2-phenyl-4-(3-phenylpropylidene)oxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,4Z)-5-oxo-2-phenyl-4-(3-phenylpropylidene)oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 10572648 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | tert-butyl N-[(2R,3S,4Z)-5-oxo-2-phenyl-4-(3-phenylpropylidene)oxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1/C(=C/CCc2ccccc2)C(=O)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H27NO4/c1-24(2,3)29-23(27)25-20-19(16-10-13-17-11-6-4-7-12-17)22(26)28-21(20)18-14-8-5-9-15-18/h4-9,11-12,14-16,20-21H,10,13H2,1-3H3,(H,25,27)/b19-16-/t20-,21+/m0/s1 |
| InChIKey | USIHHQYWIZVNAQ-HVJYCVCSSA-N |
| XLogP | 4.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|