C29H45NO — CID 10574314
(3R,5R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile (PubChem CID 10574314) has the molecular formula C29H45NO and a molecular weight of 423.69 g/mol. Its IUPAC name is (3R,5R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile.
| Compound Name | (3R,5R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile |
|---|---|
| PubChem CID | 10574314 |
| Molecular Formula | C29H45NO |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | (3R,5R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@@]4(C#N)C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C29H45NO/c1-19(2)20(3)7-8-21(4)24-9-10-25-23-12-16-29(18-30)17-22(31)11-15-28(29,6)26(23)13-14-27(24,25)5/h7-8,12,19-22,24-26,31H,9-11,13-17H2,1-6H3/b8-7+/t20-,21+,22+,24+,25-,26?,27+,28+,29-/m0/s1 |
| InChIKey | SWAFTGWZOYPFTN-ZVCJEDMMSA-N |
| XLogP | 7.30 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|