C29H44O3 — CID 125032449
(1R,5S,8S,9R,12S,13R,16R)-8-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyl-17,19-dioxapentacyclo[14.3.1.01,13.04,12.05,9]icos-3-en-18-one (PubChem CID 125032449) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is (1R,5S,8S,9R,12S,13R,16R)-8-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyl-17,19-dioxapentacyclo[14.3.1.01,13.04,12.05,9]icos-3-en-18-one.
| Compound Name | (1R,5S,8S,9R,12S,13R,16R)-8-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyl-17,19-dioxapentacyclo[14.3.1.01,13.04,12.05,9]icos-3-en-18-one |
|---|---|
| PubChem CID | 125032449 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (1R,5S,8S,9R,12S,13R,16R)-8-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-9,13-dimethyl-17,19-dioxapentacyclo[14.3.1.01,13.04,12.05,9]icos-3-en-18-one |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)[C@@H]1CC[C@@H]2C3=CC[C@@]45C[C@@H](CC[C@]4(C)[C@H]3CC[C@@]21C)OC(=O)O5 |
| InChI | InChI=1S/C29H44O3/c1-18(2)19(3)7-8-20(4)23-9-10-24-22-12-16-29-17-21(31-26(30)32-29)11-15-28(29,6)25(22)13-14-27(23,24)5/h7-8,12,18-21,23-25H,9-11,13-17H2,1-6H3/b8-7+/t19-,20+,21+,23-,24+,25-,27+,28+,29+/m0/s1 |
| InChIKey | XTMAJTPGFYBLQI-LKBNUOHGSA-N |
| XLogP | 7.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|