C19H40Si2Sn — CID 10575231
(1,1-dibutyl-2-trimethylsilyl-4H-stannin-4-yl)-trimethylsilane (PubChem CID 10575231) has the molecular formula C19H40Si2Sn and a molecular weight of 443.41 g/mol. Its IUPAC name is (1,1-dibutyl-2-trimethylsilyl-4H-stannin-4-yl)-trimethylsilane.
| Compound Name | (1,1-dibutyl-2-trimethylsilyl-4H-stannin-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 10575231 |
| Molecular Formula | C19H40Si2Sn |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (1,1-dibutyl-2-trimethylsilyl-4H-stannin-4-yl)-trimethylsilane |
| SMILES | CCCC[Sn]1(CCCC)C=CC([Si](C)(C)C)C=C1[Si](C)(C)C |
| InChI | InChI=1S/C11H22Si2.2C4H9.Sn/c1-8-11(13(5,6)7)9-10-12(2,3)4;2*1-3-4-2;/h1,8-9,11H,2-7H3;2*1,3-4H2,2H3; |
| InChIKey | JQVXCHBXXUOQOQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|