C19H32INO3 — CID 10575479
[(1R,8S,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-ethyl-dimethylazanium iodide (PubChem CID 10575479) has the molecular formula C19H32INO3 and a molecular weight of 449.37 g/mol. Its IUPAC name is [(1R,8S,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-ethyl-dimethylazanium iodide.
| Compound Name | [(1R,8S,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-ethyl-dimethylazanium iodide |
|---|---|
| PubChem CID | 10575479 |
| Molecular Formula | C19H32INO3 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [(1R,8S,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-ethyl-dimethylazanium iodide |
| SMILES | CC[N+](C)(C)CC1C(=O)O[C@@]23C1CC[C@H](C)C2CC[C@@]1(C)O[C@@H]31.[I-] |
| InChI | InChI=1S/C19H32NO3.HI/c1-6-20(4,5)11-13-15-8-7-12(2)14-9-10-18(3)17(23-18)19(14,15)22-16(13)21;/h12-15,17H,6-11H2,1-5H3;1H/q+1;/p-1/t12-,13?,14?,15?,17+,18+,19+;/m0./s1 |
| InChIKey | AEWMTCNLSOYCDS-OEANGRGVSA-M |
| XLogP | -0.39 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|