C22H38NO3+ — CID 41020354
[(1R,4R,5R,8R,9R,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-dimethyl-pentylazanium (PubChem CID 41020354) has the molecular formula C22H38NO3+ and a molecular weight of 364.55 g/mol. Its IUPAC name is [(1R,4R,5R,8R,9R,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-dimethyl-pentylazanium.
| Compound Name | [(1R,4R,5R,8R,9R,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-dimethyl-pentylazanium |
|---|---|
| PubChem CID | 41020354 |
| Molecular Formula | C22H38NO3+ |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | [(1R,4R,5R,8R,9R,12R,14R)-8,12-dimethyl-3-oxo-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-4-yl]methyl-dimethyl-pentylazanium |
| SMILES | CCCCC[N+](C)(C)C[C@@H]1C(=O)O[C@@]23[C@H](CC[C@@]4(C)O[C@@H]24)[C@H](C)CC[C@H]13 |
| InChI | InChI=1S/C22H38NO3/c1-6-7-8-13-23(4,5)14-16-18-10-9-15(2)17-11-12-21(3)20(26-21)22(17,18)25-19(16)24/h15-18,20H,6-14H2,1-5H3/q+1/t15-,16+,17-,18-,20-,21-,22-/m1/s1 |
| InChIKey | IPNLZZRAUONHGJ-VCJIBENYSA-N |
| XLogP | 3.78 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|