C24H25NO3Se — CID 10575692
(4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-5-phenylselanyloxy-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 10575692) has the molecular formula C24H25NO3Se and a molecular weight of 454.43 g/mol. Its IUPAC name is (4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-5-phenylselanyloxy-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-5-phenylselanyloxy-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 10575692 |
| Molecular Formula | C24H25NO3Se |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-5-phenylselanyloxy-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COc1ccc2c3c1O[C@H]1C=C[C@H](O[Se]c4ccccc4)[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C24H25NO3Se/c1-25-13-12-24-20-11-10-18(28-29-16-6-4-3-5-7-16)22(24)17(25)14-15-8-9-19(26-2)23(27-20)21(15)24/h3-11,17-18,20,22H,12-14H2,1-2H3/t17-,18+,20+,22-,24-/m1/s1 |
| InChIKey | NREIVLSVVIDCQK-GISKSNIRSA-N |
| XLogP | 2.47 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|