C30H31NO4 — CID 20833993
(4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-5-ol;phenoxybenzene (PubChem CID 20833993) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is (4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-5-ol;phenoxybenzene.
| Compound Name | (4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-5-ol;phenoxybenzene |
|---|---|
| PubChem CID | 20833993 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (4R,4aR,5S,7aS,12bS)-9-methoxy-3-methyl-2,4,4a,5,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-5-ol;phenoxybenzene |
| SMILES | COc1ccc2c3c1O[C@H]1C=C[C@H](O)[C@H]4[C@@H](C2)N(C)CC[C@@]341.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO3.C12H10O/c1-19-8-7-18-14-6-4-12(20)16(18)11(19)9-10-3-5-13(21-2)17(22-14)15(10)18;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h3-6,11-12,14,16,20H,7-9H2,1-2H3;1-10H/t11-,12+,14+,16-,18-;/m1./s1 |
| InChIKey | ZHRJGGZEMRUTIK-FVYMYURQSA-N |
| XLogP | 4.98 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|