C26H27NO3 — CID 102384265
(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-5-[(E)-2-phenylethenyl]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (PubChem CID 102384265) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-5-[(E)-2-phenylethenyl]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-5-[(E)-2-phenylethenyl]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
|---|---|
| PubChem CID | 102384265 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-5-[(E)-2-phenylethenyl]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](O)C=C(/C=C/c4ccccc4)[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C26H27NO3/c1-27-13-12-26-22-18(9-8-16-6-4-3-5-7-16)15-20(28)25(26)30-24-21(29-2)11-10-17(23(24)26)14-19(22)27/h3-11,15,19-20,22,25,28H,12-14H2,1-2H3/b9-8+/t19-,20+,22+,25+,26+/m1/s1 |
| InChIKey | LMTZDAQGXGLHRV-YUCCRKMMSA-N |
| XLogP | 3.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |