C18H18N6O12P2 — CID 10582089
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[8-(4-nitrophenyl)imidazo[2,1-f]purin-3-yl]oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 10582089) has the molecular formula C18H18N6O12P2 and a molecular weight of 572.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[8-(4-nitrophenyl)imidazo[2,1-f]purin-3-yl]oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[8-(4-nitrophenyl)imidazo[2,1-f]purin-3-yl]oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10582089 |
| Molecular Formula | C18H18N6O12P2 |
| Molecular Weight | 572.32 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[8-(4-nitrophenyl)imidazo[2,1-f]purin-3-yl]oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=[N+]([O-])c1ccc(-c2cn3cnc4c(ncn4[C@@H]4O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]4O)c3n2)cc1 |
| InChI | InChI=1S/C18H18N6O12P2/c25-14-12(6-34-38(32,33)36-37(29,30)31)35-18(15(14)26)23-8-19-13-16(23)20-7-22-5-11(21-17(13)22)9-1-3-10(4-2-9)24(27)28/h1-5,7-8,12,14-15,18,25-26H,6H2,(H,32,33)(H2,29,30,31)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | BGRHMSBUOMVOFY-SCFUHWHPSA-N |
| XLogP | 0.50 |
| TPSA | 254.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|