C8H12O3 — CID 10583016
ethyl (1S,5R)-6-oxabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 10583016) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is ethyl (1S,5R)-6-oxabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | ethyl (1S,5R)-6-oxabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 10583016 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | ethyl (1S,5R)-6-oxabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C8H12O3/c1-2-10-8(9)5-3-6-7(4-5)11-6/h5-7H,2-4H2,1H3/t5?,6-,7+ |
| InChIKey | BFZADIYBHRMTFZ-DGUCWDHESA-N |
| XLogP | 0.73 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|