C8H11FO3 — CID 143048725
methyl 2-fluoro-2-(6-oxabicyclo[3.1.0]hexan-2-yl)acetate (PubChem CID 143048725) has the molecular formula C8H11FO3 and a molecular weight of 174.17 g/mol. Its IUPAC name is methyl 2-fluoro-2-(6-oxabicyclo[3.1.0]hexan-2-yl)acetate.
| Compound Name | methyl 2-fluoro-2-(6-oxabicyclo[3.1.0]hexan-2-yl)acetate |
|---|---|
| PubChem CID | 143048725 |
| Molecular Formula | C8H11FO3 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | methyl 2-fluoro-2-(6-oxabicyclo[3.1.0]hexan-2-yl)acetate |
| SMILES | COC(=O)C(F)C1CCC2OC21 |
| InChI | InChI=1S/C8H11FO3/c1-11-8(10)6(9)4-2-3-5-7(4)12-5/h4-7H,2-3H2,1H3 |
| InChIKey | AFQYUEZPDOPGJS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|