C8H8N2O2 — CID 10583150
2-methyl-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 10583150) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-methyl-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-methyl-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 10583150 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2-methyl-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CN1CC(=O)n2cccc2C1=O |
| InChI | InChI=1S/C8H8N2O2/c1-9-5-7(11)10-4-2-3-6(10)8(9)12/h2-4H,5H2,1H3 |
| InChIKey | VZXBYWBGJQNJGW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |