C25H27N3O4 — CID 1058435
N-benzyl-2-[cyclopropyl-[(3-methoxyphenyl)carbamoyl]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 1058435) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-benzyl-2-[cyclopropyl-[(3-methoxyphenyl)carbamoyl]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-benzyl-2-[cyclopropyl-[(3-methoxyphenyl)carbamoyl]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1058435 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-benzyl-2-[cyclopropyl-[(3-methoxyphenyl)carbamoyl]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1cccc(NC(=O)N(CC(=O)N(Cc2ccccc2)Cc2ccco2)C2CC2)c1 |
| InChI | InChI=1S/C25H27N3O4/c1-31-22-10-5-9-20(15-22)26-25(30)28(21-12-13-21)18-24(29)27(17-23-11-6-14-32-23)16-19-7-3-2-4-8-19/h2-11,14-15,21H,12-13,16-18H2,1H3,(H,26,30) |
| InChIKey | OJIFGTNSEVVHGP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |