C25H26N2O4 — CID 1058317
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-2-methoxybenzamide (PubChem CID 1058317) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-2-methoxybenzamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 1058317 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyl-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N(CC(=O)N(Cc1ccccc1)Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C25H26N2O4/c1-30-23-12-6-5-11-22(23)25(29)27(20-13-14-20)18-24(28)26(17-21-10-7-15-31-21)16-19-8-3-2-4-9-19/h2-12,15,20H,13-14,16-18H2,1H3 |
| InChIKey | MDYRNZDJPVSZFX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |