C28H34N2O3 — CID 3644401
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyladamantane-1-carboxamide (PubChem CID 3644401) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyladamantane-1-carboxamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 3644401 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-cyclopropyladamantane-1-carboxamide |
| SMILES | O=C(CN(C(=O)C12CC3CC(CC(C3)C1)C2)C1CC1)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C28H34N2O3/c31-26(29(18-25-7-4-10-33-25)17-20-5-2-1-3-6-20)19-30(24-8-9-24)27(32)28-14-21-11-22(15-28)13-23(12-21)16-28/h1-7,10,21-24H,8-9,11-19H2 |
| InChIKey | CQIJNERFMDDBMW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |