C12H18O3 — CID 10584572
(2E,6E)-7-(1,3-dioxolan-2-yl)-3-methylocta-2,6-dienal (PubChem CID 10584572) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2E,6E)-7-(1,3-dioxolan-2-yl)-3-methylocta-2,6-dienal.
| Compound Name | (2E,6E)-7-(1,3-dioxolan-2-yl)-3-methylocta-2,6-dienal |
|---|---|
| PubChem CID | 10584572 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2E,6E)-7-(1,3-dioxolan-2-yl)-3-methylocta-2,6-dienal |
| SMILES | C/C(=C\C=O)CC/C=C(\C)C1OCCO1 |
| InChI | InChI=1S/C12H18O3/c1-10(6-7-13)4-3-5-11(2)12-14-8-9-15-12/h5-7,12H,3-4,8-9H2,1-2H3/b10-6+,11-5+ |
| InChIKey | WZQATOHLZLTQPX-NVOKHFLUSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|