C11H10O3S — CID 10585118
(1S,5R)-1-[(S)-phenylsulfinyl]-6-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 10585118) has the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. Its IUPAC name is (1S,5R)-1-[(S)-phenylsulfinyl]-6-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5R)-1-[(S)-phenylsulfinyl]-6-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 10585118 |
| Molecular Formula | C11H10O3S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (1S,5R)-1-[(S)-phenylsulfinyl]-6-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1CC[C@H]2O[C@@]12[S@@](=O)c1ccccc1 |
| InChI | InChI=1S/C11H10O3S/c12-9-6-7-10-11(9,14-10)15(13)8-4-2-1-3-5-8/h1-5,10H,6-7H2/t10-,11-,15+/m1/s1 |
| InChIKey | AXSOBFRSOWPVOI-HFAKWTLXSA-N |
| XLogP | 1.25 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|