C12H12O4S — CID 10658455
1-(benzenesulfonyl)-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 10658455) has the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | 1-(benzenesulfonyl)-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 10658455 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-(benzenesulfonyl)-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | O=C1CCCC2OC12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O4S/c13-10-7-4-8-11-12(10,16-11)17(14,15)9-5-2-1-3-6-9/h1-3,5-6,11H,4,7-8H2 |
| InChIKey | HCHLZODHAKHMPE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|