C21H32O4S — CID 15690047
2-(benzenesulfonyl)-7-hexyl-2-propyloxepan-3-one (PubChem CID 15690047) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-7-hexyl-2-propyloxepan-3-one.
| Compound Name | 2-(benzenesulfonyl)-7-hexyl-2-propyloxepan-3-one |
|---|---|
| PubChem CID | 15690047 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-(benzenesulfonyl)-7-hexyl-2-propyloxepan-3-one |
| SMILES | CCCCCCC1CCCC(=O)C(CCC)(S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C21H32O4S/c1-3-5-6-8-12-18-13-11-16-20(22)21(25-18,17-4-2)26(23,24)19-14-9-7-10-15-19/h7,9-10,14-15,18H,3-6,8,11-13,16-17H2,1-2H3 |
| InChIKey | FRMOBYOYZPJXFA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|