C18H26O4S — CID 11035149
2-(benzenesulfonyl)-7-hexyloxepan-3-one (PubChem CID 11035149) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-7-hexyloxepan-3-one.
| Compound Name | 2-(benzenesulfonyl)-7-hexyloxepan-3-one |
|---|---|
| PubChem CID | 11035149 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(benzenesulfonyl)-7-hexyloxepan-3-one |
| SMILES | CCCCCCC1CCCC(=O)C(S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C18H26O4S/c1-2-3-4-6-10-15-11-9-14-17(19)18(22-15)23(20,21)16-12-7-5-8-13-16/h5,7-8,12-13,15,18H,2-4,6,9-11,14H2,1H3 |
| InChIKey | JCZQTCVWOHJJQA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|