C17H24O4S — CID 14056124
4-(benzenesulfonyl)-6-hexyloxan-2-one (PubChem CID 14056124) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-6-hexyloxan-2-one.
| Compound Name | 4-(benzenesulfonyl)-6-hexyloxan-2-one |
|---|---|
| PubChem CID | 14056124 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-(benzenesulfonyl)-6-hexyloxan-2-one |
| SMILES | CCCCCCC1CC(S(=O)(=O)c2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C17H24O4S/c1-2-3-4-6-9-14-12-16(13-17(18)21-14)22(19,20)15-10-7-5-8-11-15/h5,7-8,10-11,14,16H,2-4,6,9,12-13H2,1H3 |
| InChIKey | PKSNHOJJPORECF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|