C13H14O3S — CID 134925724
(1R,6S)-1-(4-methylphenyl)sulfinyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 134925724) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is (1R,6S)-1-(4-methylphenyl)sulfinyl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,6S)-1-(4-methylphenyl)sulfinyl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 134925724 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (1R,6S)-1-(4-methylphenyl)sulfinyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | Cc1ccc(S(=O)[C@]23O[C@H]2CCCC3=O)cc1 |
| InChI | InChI=1S/C13H14O3S/c1-9-5-7-10(8-6-9)17(15)13-11(14)3-2-4-12(13)16-13/h5-8,12H,2-4H2,1H3/t12-,13-,17?/m0/s1 |
| InChIKey | DCVUAXKXRGKRKD-RNWUTADCSA-N |
| XLogP | 1.95 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|