C12H15F3O — CID 10585656
(E)-1,1,1-trifluorododec-5-en-3-yn-2-one (PubChem CID 10585656) has the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. Its IUPAC name is (E)-1,1,1-trifluorododec-5-en-3-yn-2-one.
| Compound Name | (E)-1,1,1-trifluorododec-5-en-3-yn-2-one |
|---|---|
| PubChem CID | 10585656 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (E)-1,1,1-trifluorododec-5-en-3-yn-2-one |
| SMILES | CCCCCC/C=C/C#CC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O/c1-2-3-4-5-6-7-8-9-10-11(16)12(13,14)15/h7-8H,2-6H2,1H3/b8-7+ |
| InChIKey | UTMIWPVKTSBPMF-BQYQJAHWSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|