C12H17N3O2 — CID 10585842
3-[[5-(furan-3-yl)-1H-pyrazol-3-yl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 10585842) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-[[5-(furan-3-yl)-1H-pyrazol-3-yl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[5-(furan-3-yl)-1H-pyrazol-3-yl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 10585842 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-[[5-(furan-3-yl)-1H-pyrazol-3-yl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1cc(-c2ccoc2)[nH]n1 |
| InChI | InChI=1S/C12H17N3O2/c1-15(2)5-3-6-17-12-8-11(13-14-12)10-4-7-16-9-10/h4,7-9H,3,5-6H2,1-2H3,(H,13,14) |
| InChIKey | FCXVQRRWLWMAFP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|