C13H15NO4 — CID 10586687
[(2S,3S)-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate (PubChem CID 10586687) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is [(2S,3S)-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate.
| Compound Name | [(2S,3S)-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 10586687 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [(2S,3S)-1-benzyl-2-hydroxy-5-oxopyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N(Cc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C13H15NO4/c1-9(15)18-11-7-12(16)14(13(11)17)8-10-5-3-2-4-6-10/h2-6,11,13,17H,7-8H2,1H3/t11-,13-/m0/s1 |
| InChIKey | ZCJLSHFSNJDCDM-AAEUAGOBSA-N |
| XLogP | 0.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |