C16H32Si — CID 10586948
tert-butyl-deca-2,3-dien-4-yl-dimethylsilane (PubChem CID 10586948) has the molecular formula C16H32Si and a molecular weight of 252.52 g/mol. Its IUPAC name is tert-butyl-deca-2,3-dien-4-yl-dimethylsilane.
| Compound Name | tert-butyl-deca-2,3-dien-4-yl-dimethylsilane |
|---|---|
| PubChem CID | 10586948 |
| Molecular Formula | C16H32Si |
| Molecular Weight | 252.52 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | tert-butyl-deca-2,3-dien-4-yl-dimethylsilane |
| SMILES | CC=C=C(CCCCCC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32Si/c1-8-10-11-12-14-15(13-9-2)17(6,7)16(3,4)5/h9H,8,10-12,14H2,1-7H3 |
| InChIKey | QGTVSUPWNPVXIW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|