C11H11ClN2OS — CID 10587097
4-chloro-N-(3-methyl-1,3-thiazolidin-2-ylidene)benzamide (PubChem CID 10587097) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 4-chloro-N-(3-methyl-1,3-thiazolidin-2-ylidene)benzamide.
| Compound Name | 4-chloro-N-(3-methyl-1,3-thiazolidin-2-ylidene)benzamide |
|---|---|
| PubChem CID | 10587097 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 4-chloro-N-(3-methyl-1,3-thiazolidin-2-ylidene)benzamide |
| SMILES | CN1CCS/C1=N\C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClN2OS/c1-14-6-7-16-11(14)13-10(15)8-2-4-9(12)5-3-8/h2-5H,6-7H2,1H3/b13-11- |
| InChIKey | SQAKOVYHZCYKQO-QBFSEMIESA-N |
| XLogP | 2.51 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|